CAS 1803590-29-5 appears in our catalog under these names: (1-(Fluoromethyl)cyclopropyl)methanamine 2,2,2-trifluoroacetate, 98%, (1-(Fluoromethyl)cyclopropyl)methanamine, trifluoroacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
[1-(fluoromethyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid (CAS 1803590-29-5) is a chemical compound with the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. IUPAC name: [1-(fluoromethyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid. InChIKey: TXLXINQRJSYVCT-UHFFFAOYSA-N.
| Molecular formula | C7H11F4NO2 |
|---|---|
| Molecular weight | 217.16 g/mol |
| IUPAC name | [1-(fluoromethyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | TXLXINQRJSYVCT-UHFFFAOYSA-N |
| SMILES | C1CC1(CN)CF.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)