Products 2940946-18-7

CAS 2940946-18-7 is the registry number for 3-(1-fluoroethyl)azetidine,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2940946-18-7) is a chemical compound with the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. IUPAC name: 3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: DOUCJAALDWRIFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11F4NO2
Molecular weight217.16 g/mol
IUPAC name3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid
InChIKeyDOUCJAALDWRIFJ-UHFFFAOYSA-N
SMILESCC(C1CNC1)F.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)