CAS 2940946-18-7 is the registry number for 3-(1-fluoroethyl)azetidine,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2940946-18-7) is a chemical compound with the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. IUPAC name: 3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: DOUCJAALDWRIFJ-UHFFFAOYSA-N.
| Molecular formula | C7H11F4NO2 |
|---|---|
| Molecular weight | 217.16 g/mol |
| IUPAC name | 3-(1-fluoroethyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | DOUCJAALDWRIFJ-UHFFFAOYSA-N |
| SMILES | CC(C1CNC1)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)