CAS 2394830-26-1 is the registry number for Rel-(2R,3R)-3-(fluoromethyl)-2-methylazetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-3-(fluoromethyl)-2-methylazetidine;2,2,2-trifluoroacetic acid (CAS 2394830-26-1) is a chemical compound with the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. IUPAC name: (2R,3R)-3-(fluoromethyl)-2-methylazetidine;2,2,2-trifluoroacetic acid. InChIKey: OSPZSLIXCYRYOB-TYSVMGFPSA-N.
| Molecular formula | C7H11F4NO2 |
|---|---|
| Molecular weight | 217.16 g/mol |
| IUPAC name | (2R,3R)-3-(fluoromethyl)-2-methylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | OSPZSLIXCYRYOB-TYSVMGFPSA-N |
| SMILES | C[C@@H]1[C@@H](CN1)CF.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)