CAS 1803590-49-9 appears in our catalog under these names: 2,6-Dimethylquinolin-8-ol hydrochloride, 95%, 2,6-Dimethylquinolin-8-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-dimethylquinolin-8-ol;hydrochloride (CAS 1803590-49-9) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 2,6-dimethylquinolin-8-ol;hydrochloride. InChIKey: ISDLRIKYAFTJIE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2,6-dimethylquinolin-8-ol;hydrochloride |
| InChIKey | ISDLRIKYAFTJIE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2O)C.Cl |
Computed by PubChem (NCBI)