CAS 1803590-96-6 appears in our catalog under these names: Methyl 5,5-dimethyl-4-(methylamino)-4,5-dihydro-1,2,4-oxadiazole-3-carboxylate, 95%, Methyl 5,5-dimethyl-4-(methylamino)-4,5-dihydro-1,2,4-oxadiazole-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 5,5-dimethyl-4-(methylamino)-1,2,4-oxadiazole-3-carboxylate (CAS 1803590-96-6) is a chemical compound with the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. IUPAC name: methyl 5,5-dimethyl-4-(methylamino)-1,2,4-oxadiazole-3-carboxylate. InChIKey: JCQPDBRFZJUHKM-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O3 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | methyl 5,5-dimethyl-4-(methylamino)-1,2,4-oxadiazole-3-carboxylate |
| InChIKey | JCQPDBRFZJUHKM-UHFFFAOYSA-N |
| SMILES | CC1(N(C(=NO1)C(=O)OC)NC)C |
Computed by PubChem (NCBI)