CAS 1803595-12-1 is the registry number for 3-(Piperidin-3-yl)-1H-1,2,4-triazol-5-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-piperidin-3-yl-1H-1,2,4-triazol-3-amine;dihydrochloride (CAS 1803595-12-1) is a chemical compound with the molecular formula C7H15Cl2N5 and a molecular weight of 240.13 g/mol. IUPAC name: 5-piperidin-3-yl-1H-1,2,4-triazol-3-amine;dihydrochloride. InChIKey: KBIFCYZCOPYVGI-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2N5 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 5-piperidin-3-yl-1H-1,2,4-triazol-3-amine;dihydrochloride |
| InChIKey | KBIFCYZCOPYVGI-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC(=NN2)N.Cl.Cl |
Computed by PubChem (NCBI)