CAS 2230789-70-3 appears in our catalog under these names: 1-Methyl-3-((2S)-pyrrolidin-2-yl)-1H-1,2,4-triazol-5-amine dihydrochloride, 95%, 1-Methyl-3-((2S)-pyrrolidin-2-yl)-1H-1,2,4-triazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-triazol-3-amine;dihydrochloride (CAS 2230789-70-3) is a chemical compound with the molecular formula C7H15Cl2N5 and a molecular weight of 240.13 g/mol. IUPAC name: 2-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-triazol-3-amine;dihydrochloride. InChIKey: AWDKTRXMLLYLPW-XRIGFGBMSA-N.
| Molecular formula | C7H15Cl2N5 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-triazol-3-amine;dihydrochloride |
| InChIKey | AWDKTRXMLLYLPW-XRIGFGBMSA-N |
| SMILES | CN1C(=NC(=N1)[C@@H]2CCCN2)N.Cl.Cl |
Computed by PubChem (NCBI)