Products 1803595-69-8

CAS 1803595-69-8 appears in our catalog under these names: 2-Chloro-5-propylbenzene-1-sulfonyl chloride, 95%, 2-Chloro-5-propylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-chloro-5-propylbenzenesulfonyl chloride (CAS 1803595-69-8) is a chemical compound with the molecular formula C9H10Cl2O2S and a molecular weight of 253.14 g/mol. IUPAC name: 2-chloro-5-propylbenzenesulfonyl chloride. InChIKey: HLQSQWXPMRSGJG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Cl2O2S
Molecular weight253.14 g/mol
IUPAC name2-chloro-5-propylbenzenesulfonyl chloride
InChIKeyHLQSQWXPMRSGJG-UHFFFAOYSA-N
SMILESCCCC1=CC(=C(C=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)