Products 1803597-45-6

CAS 1803597-45-6 is the registry number for 2-Chloro-5-(propan-2-yl)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-chloro-5-propan-2-ylbenzenesulfonyl chloride (CAS 1803597-45-6) is a chemical compound with the molecular formula C9H10Cl2O2S and a molecular weight of 253.14 g/mol. IUPAC name: 2-chloro-5-propan-2-ylbenzenesulfonyl chloride. InChIKey: FODYZJCRHYWTTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Cl2O2S
Molecular weight253.14 g/mol
IUPAC name2-chloro-5-propan-2-ylbenzenesulfonyl chloride
InChIKeyFODYZJCRHYWTTJ-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=C(C=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)