CAS 57841-07-3 is the registry number for ethyl 4,5-bis(chloromethyl)thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4,5-bis(chloromethyl)thiophene-2-carboxylate (CAS 57841-07-3) is a chemical compound with the molecular formula C9H10Cl2O2S and a molecular weight of 253.14 g/mol. IUPAC name: ethyl 4,5-bis(chloromethyl)thiophene-2-carboxylate. InChIKey: QBIISRPFQMAHGA-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2S |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | ethyl 4,5-bis(chloromethyl)thiophene-2-carboxylate |
| InChIKey | QBIISRPFQMAHGA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(S1)CCl)CCl |
Computed by PubChem (NCBI)