CAS 1803596-08-8 is the registry number for Ethyl 3-(3-aminobenzamido)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
Ethyl 3-[(3-aminobenzoyl)amino]benzoate;hydrochloride (CAS 1803596-08-8) is a chemical compound with the molecular formula C16H17ClN2O3 and a molecular weight of 320.77 g/mol. IUPAC name: ethyl 3-[(3-aminobenzoyl)amino]benzoate;hydrochloride. InChIKey: QLOXHWZBRYUJRV-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O3 |
|---|---|
| Molecular weight | 320.77 g/mol |
| IUPAC name | ethyl 3-[(3-aminobenzoyl)amino]benzoate;hydrochloride |
| InChIKey | QLOXHWZBRYUJRV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC(=O)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)