Products 922507-80-0
CAS 922507-80-0 appears in our catalog under these names: 16F16, PDI-IN-3, 98.0%, 16F16, 98% (HPLC). Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 10 mg, 5 mg, 1 mg, 100mg.
Methyl 2-(2-chloroacetyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate (CAS 922507-80-0) is a chemical compound with the molecular formula C16H17ClN2O3 and a molecular weight of 320.77 g/mol. IUPAC name: methyl 2-(2-chloroacetyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate. InChIKey: BCSIRYFYAKLJDK-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O3 |
|---|---|
| Molecular weight | 320.77 g/mol |
| IUPAC name | methyl 2-(2-chloroacetyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
| InChIKey | BCSIRYFYAKLJDK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CCN1C(=O)CCl)C3=CC=CC=C3N2)C(=O)OC |
Computed by PubChem (NCBI)