CAS 438221-50-2 is the registry number for 3-((4-Chloro-3-methylphenoxy)methyl)-4-methoxybenzohydrazide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzohydrazide (CAS 438221-50-2) is a chemical compound with the molecular formula C16H17ClN2O3 and a molecular weight of 320.77 g/mol. IUPAC name: 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzohydrazide. InChIKey: SKVWACOAKXBQGM-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O3 |
|---|---|
| Molecular weight | 320.77 g/mol |
| IUPAC name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzohydrazide |
| InChIKey | SKVWACOAKXBQGM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=C(C=CC(=C2)C(=O)NN)OC)Cl |
Computed by PubChem (NCBI)