CAS 1803597-05-8 appears in our catalog under these names: 5-aminopentan-2-one trifluoroacetic acid, 95%, 5-Aminopentan-2-one 2,2,2-trifluoroacetate, 97%, 5-Aminopentan-2-one, trifluoroacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
5-aminopentan-2-one;2,2,2-trifluoroacetic acid (CAS 1803597-05-8) is a chemical compound with the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. IUPAC name: 5-aminopentan-2-one;2,2,2-trifluoroacetic acid. InChIKey: NFCPMCYJTBCULO-UHFFFAOYSA-N.
| Molecular formula | C7H12F3NO3 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 5-aminopentan-2-one;2,2,2-trifluoroacetic acid |
| InChIKey | NFCPMCYJTBCULO-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)