CAS 935668-28-3 is the registry number for (S)-2-(Methoxymethyl)azetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(methoxymethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 935668-28-3) is a chemical compound with the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. IUPAC name: (2S)-2-(methoxymethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: PUHVQADTSWMROX-JEDNCBNOSA-N.
| Molecular formula | C7H12F3NO3 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | (2S)-2-(methoxymethyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | PUHVQADTSWMROX-JEDNCBNOSA-N |
| SMILES | COC[C@@H]1CCN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)