CAS 1955557-74-0 is the registry number for 1-(Azetidin-3-yl)ethan-1-ol, trifluoroacetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(azetidin-3-yl)ethanol;2,2,2-trifluoroacetic acid (CAS 1955557-74-0) is a chemical compound with the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. IUPAC name: 1-(azetidin-3-yl)ethanol;2,2,2-trifluoroacetic acid. InChIKey: HWWQEEIYBXOCGS-UHFFFAOYSA-N.
| Molecular formula | C7H12F3NO3 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 1-(azetidin-3-yl)ethanol;2,2,2-trifluoroacetic acid |
| InChIKey | HWWQEEIYBXOCGS-UHFFFAOYSA-N |
| SMILES | CC(C1CNC1)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)