CAS 1803598-34-6 appears in our catalog under these names: Sodium 5-tert-butyl-1,3,4-thiadiazole-2-carboxylate, 95%, Sodium 5-tert-butyl-1,3,4-thiadiazole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 5-tert-butyl-1,3,4-thiadiazole-2-carboxylate (CAS 1803598-34-6) is a chemical compound with the molecular formula C7H9N2NaO2S and a molecular weight of 208.22 g/mol. IUPAC name: sodium 5-tert-butyl-1,3,4-thiadiazole-2-carboxylate. InChIKey: MMVXUXGVDFEKBJ-UHFFFAOYSA-M.
| Molecular formula | C7H9N2NaO2S |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | sodium 5-tert-butyl-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | MMVXUXGVDFEKBJ-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=NN=C(S1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)