CAS 2411266-24-3 is the registry number for Sodium 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate (CAS 2411266-24-3) is a chemical compound with the molecular formula C7H9N2NaO2S and a molecular weight of 208.22 g/mol. IUPAC name: sodium 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: WXOFTQURDHDWGZ-UHFFFAOYSA-M.
| Molecular formula | C7H9N2NaO2S |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | sodium 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | WXOFTQURDHDWGZ-UHFFFAOYSA-M |
| SMILES | CC1=C(SC(=N1)C(C)N)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)