CAS 1909325-38-7 appears in our catalog under these names: Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-methylpropanoate, 95%, Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-methylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-methylpropanoate (CAS 1909325-38-7) is a chemical compound with the molecular formula C7H9N2NaO2S and a molecular weight of 208.22 g/mol. IUPAC name: sodium 2-(2-amino-1,3-thiazol-4-yl)-2-methylpropanoate. InChIKey: QJDIGRDKEHHFGF-UHFFFAOYSA-M.
| Molecular formula | C7H9N2NaO2S |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | sodium 2-(2-amino-1,3-thiazol-4-yl)-2-methylpropanoate |
| InChIKey | QJDIGRDKEHHFGF-UHFFFAOYSA-M |
| SMILES | CC(C)(C1=CSC(=N1)N)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)