Products 1803599-62-3
CAS 1803599-62-3 appears in our catalog under these names: 2-(8-Chloro-3,4-dihydro-2H-1-benzopyran-6-yl)acetonitrile, 95%, 2-(8-Chloro-3,4-dihydro-2H-1-benzopyran-6-yl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(8-chloro-3,4-dihydro-2H-chromen-6-yl)acetonitrile (CAS 1803599-62-3) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 2-(8-chloro-3,4-dihydro-2H-chromen-6-yl)acetonitrile. InChIKey: OGCYQIBWMPUKDV-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-(8-chloro-3,4-dihydro-2H-chromen-6-yl)acetonitrile |
| InChIKey | OGCYQIBWMPUKDV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)CC#N)Cl)OC1 |
Computed by PubChem (NCBI)