Products 1803601-45-7
CAS 1803601-45-7 appears in our catalog under these names: 1-Amino-4,4-dimethylcyclohexane-1-carboxylic acid hydrochloride, 95%, 1-Amino-4,4-dimethylcyclohexane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-amino-4,4-dimethylcyclohexane-1-carboxylic acid;hydrochloride (CAS 1803601-45-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: 1-amino-4,4-dimethylcyclohexane-1-carboxylic acid;hydrochloride. InChIKey: HOEAITZTGWKERS-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 1-amino-4,4-dimethylcyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | HOEAITZTGWKERS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C(=O)O)N)C.Cl |
Computed by PubChem (NCBI)