Products 1803603-70-4
CAS 1803603-70-4 is the registry number for 2-Methyl-3-(1,3-oxazol-2-yl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-3-(1,3-oxazol-2-yl)aniline;hydrochloride (CAS 1803603-70-4) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 2-methyl-3-(1,3-oxazol-2-yl)aniline;hydrochloride. InChIKey: UWYSFRIPZDDFCR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-methyl-3-(1,3-oxazol-2-yl)aniline;hydrochloride |
| InChIKey | UWYSFRIPZDDFCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=NC=CO2.Cl |
Computed by PubChem (NCBI)