CAS 1803605-85-7 is the registry number for 1-2-Cyano-6-methylphenoxy-N,N-dimethylmethanethioamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
O-(2-cyano-6-methylphenyl) N,N-dimethylcarbamothioate (CAS 1803605-85-7) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: O-(2-cyano-6-methylphenyl) N,N-dimethylcarbamothioate. InChIKey: OVQOTXQRTQTLAE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | O-(2-cyano-6-methylphenyl) N,N-dimethylcarbamothioate |
| InChIKey | OVQOTXQRTQTLAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C#N)OC(=S)N(C)C |
Computed by PubChem (NCBI)