CAS 1803606-95-2 is the registry number for Ethyl 2-(1-chloroethyl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-(1-chloroethyl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate (CAS 1803606-95-2) is a chemical compound with the molecular formula C9H9ClF3NO3 and a molecular weight of 271.62 g/mol. IUPAC name: ethyl 2-(1-chloroethyl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate. InChIKey: IWPIASLCFMHKBM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO3 |
|---|---|
| Molecular weight | 271.62 g/mol |
| IUPAC name | ethyl 2-(1-chloroethyl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | IWPIASLCFMHKBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(O1)C(C)Cl)C(F)(F)F |
Computed by PubChem (NCBI)