CAS 1820603-68-6 is the registry number for 3-(Trifluoromethoxy)-dl-phenylglycine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid;hydrochloride (CAS 1820603-68-6) is a chemical compound with the molecular formula C9H9ClF3NO3 and a molecular weight of 271.62 g/mol. IUPAC name: 2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid;hydrochloride. InChIKey: DXJPAFWHCBBMEQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO3 |
|---|---|
| Molecular weight | 271.62 g/mol |
| IUPAC name | 2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid;hydrochloride |
| InChIKey | DXJPAFWHCBBMEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)