Products 2137469-77-1

CAS 2137469-77-1 is the registry number for 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride (CAS 2137469-77-1) is a chemical compound with the molecular formula C9H9ClF3NO3 and a molecular weight of 271.62 g/mol. IUPAC name: 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride. InChIKey: ZHZRDBZDYZDFQX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClF3NO3
Molecular weight271.62 g/mol
IUPAC name2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride
InChIKeyZHZRDBZDYZDFQX-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(C(=O)O)N)OC(F)(F)F.Cl

Computed by PubChem (NCBI)