CAS 2137469-77-1 is the registry number for 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride (CAS 2137469-77-1) is a chemical compound with the molecular formula C9H9ClF3NO3 and a molecular weight of 271.62 g/mol. IUPAC name: 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride. InChIKey: ZHZRDBZDYZDFQX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO3 |
|---|---|
| Molecular weight | 271.62 g/mol |
| IUPAC name | 2-amino-2-[2-(trifluoromethoxy)phenyl]acetic acid;hydrochloride |
| InChIKey | ZHZRDBZDYZDFQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)