Products 1803607-38-6

CAS 1803607-38-6 is the registry number for 2-(1-Methylcyclopropyl)ethyl benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(1-methylcyclopropyl)ethyl benzoate (CAS 1803607-38-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2-(1-methylcyclopropyl)ethyl benzoate. InChIKey: KHZJRXSLRQNKQS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O2
Molecular weight204.26 g/mol
IUPAC name2-(1-methylcyclopropyl)ethyl benzoate
InChIKeyKHZJRXSLRQNKQS-UHFFFAOYSA-N
SMILESCC1(CC1)CCOC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)