CAS 1803607-76-2 appears in our catalog under these names: 2-({(4-(3-Bromophenyl)-1,3-thiazol-2-yl)methyl}amino)ethan-1-ol, 2-({(4-(3-bromophenyl)-1,3-thiazol-2-yl)methyl}amino)ethan-1-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]methylamino]ethanol (CAS 1803607-76-2) is a chemical compound with the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. IUPAC name: 2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]methylamino]ethanol. InChIKey: QBMJRVKNGHKVHS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2OS |
|---|---|
| Molecular weight | 313.22 g/mol |
| IUPAC name | 2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]methylamino]ethanol |
| InChIKey | QBMJRVKNGHKVHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CSC(=N2)CNCCO |
Computed by PubChem (NCBI)