CAS 944888-02-2 is the registry number for 2-Bromo-N-(6-methylbenzo[d]thiazol-2-yl)butanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide (CAS 944888-02-2) is a chemical compound with the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. IUPAC name: 2-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide. InChIKey: UKZCKRVCXRUMEH-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2OS |
|---|---|
| Molecular weight | 313.22 g/mol |
| IUPAC name | 2-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide |
| InChIKey | UKZCKRVCXRUMEH-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NC1=NC2=C(S1)C=C(C=C2)C)Br |
Computed by PubChem (NCBI)