CAS 376349-30-3 is the registry number for 7-Methoxy-4,5-dihydronaphtho[1,2-d][1,3]thiazol-2-amine hydrobromide, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide (CAS 376349-30-3) is a chemical compound with the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. IUPAC name: 7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide. InChIKey: FXXPKXPMSFTVBM-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2OS |
|---|---|
| Molecular weight | 313.22 g/mol |
| IUPAC name | 7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide |
| InChIKey | FXXPKXPMSFTVBM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(CC2)SC(=N3)N.Br |
Computed by PubChem (NCBI)