CAS 1803608-18-5 appears in our catalog under these names: 4-Methylquinolin-8-ol hydrobromide, 95%, 4-Methylquinolin-8-ol hydrobromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g.
4-methylquinolin-8-ol;hydrobromide (CAS 1803608-18-5) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-methylquinolin-8-ol;hydrobromide. InChIKey: OIXMXDNUPQEYFN-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-methylquinolin-8-ol;hydrobromide |
| InChIKey | OIXMXDNUPQEYFN-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=C(C2=NC=C1)O.Br |
Computed by PubChem (NCBI)