Products 1803610-28-7
CAS 1803610-28-7 is the registry number for 4-(3-Chlorophenyl)-4-methyl-2,6-dioxopiperidine-3,5-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-chlorophenyl)-4-methyl-2,6-dioxopiperidine-3,5-dicarbonitrile (CAS 1803610-28-7) is a chemical compound with the molecular formula C14H10ClN3O2 and a molecular weight of 287.70 g/mol. IUPAC name: 4-(3-chlorophenyl)-4-methyl-2,6-dioxopiperidine-3,5-dicarbonitrile. InChIKey: TUOVZDIOMLOVGI-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O2 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-4-methyl-2,6-dioxopiperidine-3,5-dicarbonitrile |
| InChIKey | TUOVZDIOMLOVGI-UHFFFAOYSA-N |
| SMILES | CC1(C(C(=O)NC(=O)C1C#N)C#N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)