Products 1803610-49-2
CAS 1803610-49-2 is the registry number for 1-(Difluoromethoxy)-2,5-difluoro-4-nitrobenzene. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
1-(difluoromethoxy)-2,5-difluoro-4-nitrobenzene (CAS 1803610-49-2) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 1-(difluoromethoxy)-2,5-difluoro-4-nitrobenzene. InChIKey: VITIKGAJQMJZFF-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 1-(difluoromethoxy)-2,5-difluoro-4-nitrobenzene |
| InChIKey | VITIKGAJQMJZFF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)OC(F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)