CAS 1803610-69-6 appears in our catalog under these names: 3-{1-((tert-butoxy)carbonyl)piperidin-3-yl}-1H-pyrazole-4-carboxylic acid, 95%, 3-{1-((tert-Butoxy)carbonyl)piperidin-3-yl}-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 25mg, 100mg, 250mg, 500mg.
5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1H-pyrazole-4-carboxylic acid (CAS 1803610-69-6) is a chemical compound with the molecular formula C14H21N3O4 and a molecular weight of 295.33 g/mol. IUPAC name: 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1H-pyrazole-4-carboxylic acid. InChIKey: VGSGJTQWUGFETH-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O4 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1H-pyrazole-4-carboxylic acid |
| InChIKey | VGSGJTQWUGFETH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=C(C=NN2)C(=O)O |
Computed by PubChem (NCBI)