CAS 1803610-95-8 appears in our catalog under these names: 3-(4-Nitrophenoxy)azetidine hydrochloride, 98%, 3-(4-Nitrophenoxy)azetidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(4-nitrophenoxy)azetidine;hydrochloride (CAS 1803610-95-8) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: 3-(4-nitrophenoxy)azetidine;hydrochloride. InChIKey: MLVOMRFYSHTTCK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 3-(4-nitrophenoxy)azetidine;hydrochloride |
| InChIKey | MLVOMRFYSHTTCK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)