CAS 1803715-37-8 is the registry number for 2,6–Difluoro–3,4–dibromo–1–nitrobenzene. Offered by: GLPBio. Available pack sizes: 250mg.
1,2-dibromo-3,5-difluoro-4-nitrobenzene (CAS 1803715-37-8) is a chemical compound with the molecular formula C6HBr2F2NO2 and a molecular weight of 316.88 g/mol. IUPAC name: 1,2-dibromo-3,5-difluoro-4-nitrobenzene. InChIKey: SOYUTSGUKNIBEV-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2NO2 |
|---|---|
| Molecular weight | 316.88 g/mol |
| IUPAC name | 1,2-dibromo-3,5-difluoro-4-nitrobenzene |
| InChIKey | SOYUTSGUKNIBEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)