CAS 325461-60-7 appears in our catalog under these names: 2,6–Dibromo–3,5–difluoroisonicotinic acid, 2,6-Dibromo-3,5-difluoroisonicotinic acid 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g.
2,6-dibromo-3,5-difluoropyridine-4-carboxylic acid (CAS 325461-60-7) is a chemical compound with the molecular formula C6HBr2F2NO2 and a molecular weight of 316.88 g/mol. IUPAC name: 2,6-dibromo-3,5-difluoropyridine-4-carboxylic acid. InChIKey: QGQWDPUTSPOCDM-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2NO2 |
|---|---|
| Molecular weight | 316.88 g/mol |
| IUPAC name | 2,6-dibromo-3,5-difluoropyridine-4-carboxylic acid |
| InChIKey | QGQWDPUTSPOCDM-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1F)Br)Br)F)C(=O)O |
Computed by PubChem (NCBI)