Products 1804413-71-5
CAS 1804413-71-5 appears in our catalog under these names: 2，6–Difluoro–3，5–dibromo–1–nitrobenzene, 1,5-Dibromo-2,4-Difluoro-3-Nitrobenzene, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1,5-dibromo-2,4-difluoro-3-nitrobenzene (CAS 1804413-71-5) is a chemical compound with the molecular formula C6HBr2F2NO2 and a molecular weight of 316.88 g/mol. IUPAC name: 1,5-dibromo-2,4-difluoro-3-nitrobenzene. InChIKey: KPWYRXMTHHIOQO-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2NO2 |
|---|---|
| Molecular weight | 316.88 g/mol |
| IUPAC name | 1,5-dibromo-2,4-difluoro-3-nitrobenzene |
| InChIKey | KPWYRXMTHHIOQO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)