Products 1803809-94-0
CAS 1803809-94-0 is the registry number for 3,4-Difluoro-2-(trifluoromethyl)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-difluoro-2-(trifluoromethyl)benzonitrile (CAS 1803809-94-0) is a chemical compound with the molecular formula C8H2F5N and a molecular weight of 207.10 g/mol. IUPAC name: 3,4-difluoro-2-(trifluoromethyl)benzonitrile. InChIKey: YXYGZBQVDDECAO-UHFFFAOYSA-N.
| Molecular formula | C8H2F5N |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 3,4-difluoro-2-(trifluoromethyl)benzonitrile |
| InChIKey | YXYGZBQVDDECAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)C(F)(F)F)F)F |
Computed by PubChem (NCBI)