Products 261945-24-8
CAS 261945-24-8 appears in our catalog under these names: 2,5-Difluoro-4-(trifluoromethyl)benzonitrile, 95%, 2,5-Difluoro-4-(trifluoromethyl)benzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
2,5-difluoro-4-(trifluoromethyl)benzonitrile (CAS 261945-24-8) is a chemical compound with the molecular formula C8H2F5N and a molecular weight of 207.10 g/mol. IUPAC name: 2,5-difluoro-4-(trifluoromethyl)benzonitrile. InChIKey: UIUJARXSZPKAQW-UHFFFAOYSA-N.
| Molecular formula | C8H2F5N |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 2,5-difluoro-4-(trifluoromethyl)benzonitrile |
| InChIKey | UIUJARXSZPKAQW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(F)(F)F)F)C#N |
Computed by PubChem (NCBI)