CAS 186517-05-5 appears in our catalog under these names: 2,3-Difluoro-6-(trifluoromethyl)benzonitrile, 95%, 2,3–Difluoro–6–(Trifluoromethyl)Benzonitrile, 2,3-Difluoro-6-(trifluoromethyl)benzonitrile 95%, 2,3-Difluoro-6-(trifluoromethyl)benzonitrile, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g.
2,3-difluoro-6-(trifluoromethyl)benzonitrile (CAS 186517-05-5) is a chemical compound with the molecular formula C8H2F5N and a molecular weight of 207.10 g/mol. IUPAC name: 2,3-difluoro-6-(trifluoromethyl)benzonitrile. InChIKey: QODCSKFZMRDUMK-UHFFFAOYSA-N.
| Molecular formula | C8H2F5N |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 2,3-difluoro-6-(trifluoromethyl)benzonitrile |
| InChIKey | QODCSKFZMRDUMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C#N)F)F |
Computed by PubChem (NCBI)