Products 1803827-03-3
CAS 1803827-03-3 is the registry number for 2,3-Difluoro-1-nitro-4-(trifluoromethyl)benzene, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,3-difluoro-1-nitro-4-(trifluoromethyl)benzene (CAS 1803827-03-3) is a chemical compound with the molecular formula C7H2F5NO2 and a molecular weight of 227.09 g/mol. IUPAC name: 2,3-difluoro-1-nitro-4-(trifluoromethyl)benzene. InChIKey: MYXSSDOZMIRVJF-UHFFFAOYSA-N.
| Molecular formula | C7H2F5NO2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2,3-difluoro-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | MYXSSDOZMIRVJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)