Products 2837-22-1
CAS 2837-22-1 appears in our catalog under these names: 2,5-Difluoro-3-nitrobenzotrifluoride, 95+%, 2,5-Difluoro-3-nitrobenzotrifluoride, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2,5-difluoro-1-nitro-3-(trifluoromethyl)benzene (CAS 2837-22-1) is a chemical compound with the molecular formula C7H2F5NO2 and a molecular weight of 227.09 g/mol. IUPAC name: 2,5-difluoro-1-nitro-3-(trifluoromethyl)benzene. InChIKey: VJNPKYLIWUUCOU-UHFFFAOYSA-N.
| Molecular formula | C7H2F5NO2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2,5-difluoro-1-nitro-3-(trifluoromethyl)benzene |
| InChIKey | VJNPKYLIWUUCOU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)