CAS 2731008-98-1 is the registry number for 2,2-Difluoro-2-(3,5,6-trifluoropyridin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-(3,5,6-trifluoro-2-pyridinyl)acetic acid (CAS 2731008-98-1) is a chemical compound with the molecular formula C7H2F5NO2 and a molecular weight of 227.09 g/mol. IUPAC name: 2,2-difluoro-2-(3,5,6-trifluoro-2-pyridinyl)acetic acid. InChIKey: WFVDDZLMFSFKDR-UHFFFAOYSA-N.
| Molecular formula | C7H2F5NO2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2,2-difluoro-2-(3,5,6-trifluoro-2-pyridinyl)acetic acid |
| InChIKey | WFVDDZLMFSFKDR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)F)C(C(=O)O)(F)F)F |
Computed by PubChem (NCBI)