Products 1803833-24-0
CAS 1803833-24-0 appears in our catalog under these names: 2-Fluoro-4-methyl-5-nitrobenzyl bromide, 95%, 2-Fluoro-4-methyl-5-nitrobenzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-(bromomethyl)-2-fluoro-4-methyl-5-nitrobenzene (CAS 1803833-24-0) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: 1-(bromomethyl)-2-fluoro-4-methyl-5-nitrobenzene. InChIKey: JQPYTKHUFDLKBT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | 1-(bromomethyl)-2-fluoro-4-methyl-5-nitrobenzene |
| InChIKey | JQPYTKHUFDLKBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])CBr)F |
Computed by PubChem (NCBI)