Products 1803834-94-7
CAS 1803834-94-7 appears in our catalog under these names: Methyl 5-fluoro-2-(trifluoromethyl)isonicotinate, Methyl 5-fluoro-2-(trifluoromethyl)-4-py. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 1g.
Methyl 5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylate (CAS 1803834-94-7) is a chemical compound with the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. IUPAC name: methyl 5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylate. InChIKey: WFLNJACMCXKWJT-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO2 |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | methyl 5-fluoro-2-(trifluoromethyl)pyridine-4-carboxylate |
| InChIKey | WFLNJACMCXKWJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1F)C(F)(F)F |
Computed by PubChem (NCBI)