CAS 1803997-98-9 appears in our catalog under these names: 2–(Difluoromethyl)pyridine–3–carboxamide, 2-(Difluoromethyl)pyridine-3-carboxamide, 95%, 95%, 2-(Difluoromethyl)pyridine-3-carboxamide, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(difluoromethyl)pyridine-3-carboxamide (CAS 1803997-98-9) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2-(difluoromethyl)pyridine-3-carboxamide. InChIKey: PILIHOOIKRRDRD-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-(difluoromethyl)pyridine-3-carboxamide |
| InChIKey | PILIHOOIKRRDRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(F)F)C(=O)N |
Computed by PubChem (NCBI)