Products 1804052-03-6
CAS 1804052-03-6 is the registry number for ethyl 4-bromo-3H-benzimidazole-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Ethyl 4-bromo-1H-benzimidazole-5-carboxylate (CAS 1804052-03-6) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 4-bromo-1H-benzimidazole-5-carboxylate. InChIKey: CQLBRRPRZSPFER-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 4-bromo-1H-benzimidazole-5-carboxylate |
| InChIKey | CQLBRRPRZSPFER-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=C1)NC=N2)Br |
Computed by PubChem (NCBI)