CAS 1805-22-7 is the registry number for 1,1,2,2,3,3,4,4,5-Nonafluoro-5-(Trifluoromethyl)-Cyclopentane. Offered by: Biosynth. Available pack sizes: 50g, 100g, 250g.
1,1,2,2,3,3,4,4,5-nonafluoro-5-(trifluoromethyl)cyclopentane (CAS 1805-22-7) is a chemical compound with the molecular formula C6F12 and a molecular weight of 300.04 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5-nonafluoro-5-(trifluoromethyl)cyclopentane. InChIKey: BCNXQFASJTYKDJ-UHFFFAOYSA-N.
| Molecular formula | C6F12 |
|---|---|
| Molecular weight | 300.04 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5-nonafluoro-5-(trifluoromethyl)cyclopentane |
| InChIKey | BCNXQFASJTYKDJ-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)