CAS 3709-70-4 is the registry number for (2Z)-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 500g, 1g.
(Z)-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene (CAS 3709-70-4) is a chemical compound with the molecular formula C6F12 and a molecular weight of 300.04 g/mol. IUPAC name: (Z)-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene. InChIKey: SAPOZTRFWJZUFT-UPHRSURJSA-N.
| Molecular formula | C6F12 |
|---|---|
| Molecular weight | 300.04 g/mol |
| IUPAC name | (Z)-1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene |
| InChIKey | SAPOZTRFWJZUFT-UPHRSURJSA-N |
| SMILES | C(=C(\C(F)(F)F)/F)(\C(C(F)(F)F)(C(F)(F)F)F)/F |
Computed by PubChem (NCBI)